C44H30N2O — CID 142481787
2-[(7Z,9Z)-3'-dibenzofuran-3-yl-5'-methanimidoyl-6-methylidenespiro[benzo[8]annulene-5,9'-fluorene]-1-yl]aniline (PubChem CID 142481787) has the molecular formula C44H30N2O and a molecular weight of 602.74 g/mol. Its IUPAC name is 2-[(7Z,9Z)-3'-dibenzofuran-3-yl-5'-methanimidoyl-6-methylidenespiro[benzo[8]annulene-5,9'-fluorene]-1-yl]aniline.
| Compound Name | 2-[(7Z,9Z)-3'-dibenzofuran-3-yl-5'-methanimidoyl-6-methylidenespiro[benzo[8]annulene-5,9'-fluorene]-1-yl]aniline |
|---|---|
| PubChem CID | 142481787 |
| Molecular Formula | C44H30N2O |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 2-[(7Z,9Z)-3'-dibenzofuran-3-yl-5'-methanimidoyl-6-methylidenespiro[benzo[8]annulene-5,9'-fluorene]-1-yl]aniline |
| SMILES | [H]/N=C/c1cccc2c1-c1cc(-c3ccc4c(c3)oc3ccccc34)ccc1C21C(=C)/C=C\C=C/c2c(-c3ccccc3N)cccc21 |
| InChI | InChI=1S/C44H30N2O/c1-27-10-2-3-12-32-31(33-13-4-6-18-40(33)46)15-9-16-37(32)44(27)38-23-21-28(24-36(38)43-30(26-45)11-8-17-39(43)44)29-20-22-35-34-14-5-7-19-41(34)47-42(35)25-29/h2-26,45H,1,46H2/b10-2-,12-3-,45-26+ |
| InChIKey | NMQPHTNCGXGVIQ-HNANVJIRSA-N |
| XLogP | 10.95 |
| TPSA | 63.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|