About 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane
2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane (PubChem CID 142482209) has the molecular formula C14H17N5OS
and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane.
Molecular Properties
| Compound Name | 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane |
| PubChem CID | 142482209 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane |
| SMILES | CCC.NCc1nc2cc(-c3ccncn3)sc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H9N5OS.C3H8/c12-4-9-15-7-3-8(6-1-2-13-5-14-6)18-10(7)11(17)16-9;1-3-2/h1-3,5H,4,12H2,(H,15,16,17);3H2,1-2H3 |
| InChIKey | ZIKBGMUQMBDMGH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane?
The IUPAC name of 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane (CID 142482209) is 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane.
What is the SMILES notation for 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane?
The canonical SMILES for 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane is CCC.NCc1nc2cc(-c3ccncn3)sc2c(=O)[nH]1.
What is the InChIKey of 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane?
The InChIKey is ZIKBGMUQMBDMGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5OS.C3H8/c12-4-9-15-7-3-8(6-1-2-13-5-14-6)18-10(7)11(17)16-9;1-3-2/h1-3,5H,4,12H2,(H,15,16,17);3H2,1-2H3.
What are the key properties of 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane?
2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane has a molecular weight of 303.39 g/mol, XLogP of 2.32, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-6-pyrimidin-4-yl-3H-thieno[3,2-d]pyrimidin-4-one;propane is sourced from PubChem (CID 142482209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).