About (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane
(E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane (PubChem CID 142482333) has the molecular formula C11H19F2NO
and a molecular weight of 219.28 g/mol. Its IUPAC name is (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane.
Molecular Properties
| Compound Name | (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane |
| PubChem CID | 142482333 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane |
| SMILES | CC.CCC(=O)/C=C/CN1CC(F)(F)C1 |
| InChI | InChI=1S/C9H13F2NO.C2H6/c1-2-8(13)4-3-5-12-6-9(10,11)7-12;1-2/h3-4H,2,5-7H2,1H3;1-2H3/b4-3+; |
| InChIKey | WNPRXJFFMCFBFY-BJILWQEISA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane?
The IUPAC name of (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane (CID 142482333) is (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane.
What is the SMILES notation for (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane?
The canonical SMILES for (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane is CC.CCC(=O)/C=C/CN1CC(F)(F)C1.
What is the InChIKey of (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane?
The InChIKey is WNPRXJFFMCFBFY-BJILWQEISA-N. The full InChI is InChI=1S/C9H13F2NO.C2H6/c1-2-8(13)4-3-5-12-6-9(10,11)7-12;1-2/h3-4H,2,5-7H2,1H3;1-2H3/b4-3+;.
What are the key properties of (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane?
(E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane has a molecular weight of 219.28 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-(3,3-difluoroazetidin-1-yl)hex-4-en-3-one;ethane is sourced from PubChem (CID 142482333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).