C9H14N2 — CID 142482548
3-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]propanenitrile (PubChem CID 142482548) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]propanenitrile.
| Compound Name | 3-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 142482548 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]propanenitrile |
| SMILES | C/C=C\C(=C/C)NCCC#N |
| InChI | InChI=1S/C9H14N2/c1-3-6-9(4-2)11-8-5-7-10/h3-4,6,11H,5,8H2,1-2H3/b6-3-,9-4+ |
| InChIKey | VWEIPJBAQZKEPS-BDAIYAMOSA-N |
| XLogP | 1.97 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|