C18H9F7N6O — CID 142482675
5-N-[3,5-bis(trifluoromethyl)phenyl]-6-N-(2-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 142482675) has the molecular formula C18H9F7N6O and a molecular weight of 458.30 g/mol. Its IUPAC name is 5-N-[3,5-bis(trifluoromethyl)phenyl]-6-N-(2-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 5-N-[3,5-bis(trifluoromethyl)phenyl]-6-N-(2-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 142482675 |
| Molecular Formula | C18H9F7N6O |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 5-N-[3,5-bis(trifluoromethyl)phenyl]-6-N-(2-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | Fc1ccccc1Nc1nc2nonc2nc1Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H9F7N6O/c19-11-3-1-2-4-12(11)27-14-13(28-15-16(29-14)31-32-30-15)26-10-6-8(17(20,21)22)5-9(7-10)18(23,24)25/h1-7H,(H,26,28,30)(H,27,29,31) |
| InChIKey | KIMLWSBQLYBGSW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |