C23H29F3N6O4S — CID 142483090
N-[1-[4-[[3-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazol-3-yl]methanesulfonamide (PubChem CID 142483090) has the molecular formula C23H29F3N6O4S and a molecular weight of 542.58 g/mol. Its IUPAC name is N-[1-[4-[[3-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazol-3-yl]methanesulfonamide.
| Compound Name | N-[1-[4-[[3-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazol-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 142483090 |
| Molecular Formula | C23H29F3N6O4S |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | N-[1-[4-[[3-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazol-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccn(C(=O)N2CCN(Cc3ccc(C(F)(F)F)c(N4CC5COCC5C4)c3)CC2)n1 |
| InChI | InChI=1S/C23H29F3N6O4S/c1-37(34,35)28-21-4-5-32(27-21)22(33)30-8-6-29(7-9-30)11-16-2-3-19(23(24,25)26)20(10-16)31-12-17-14-36-15-18(17)13-31/h2-5,10,17-18H,6-9,11-15H2,1H3,(H,27,28) |
| InChIKey | QXBUKOMUNUGHTN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |