C22H24BN3O3 — CID 142483347
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 142483347) has the molecular formula C22H24BN3O3 and a molecular weight of 389.26 g/mol. Its IUPAC name is 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 142483347 |
| Molecular Formula | C22H24BN3O3 |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | CC1(C)OB(c2ccc(-c3nc4cccc5c4n3CCNC5=O)cc2)OC1(C)C |
| InChI | InChI=1S/C22H24BN3O3/c1-21(2)22(3,4)29-23(28-21)15-10-8-14(9-11-15)19-25-17-7-5-6-16-18(17)26(19)13-12-24-20(16)27/h5-11H,12-13H2,1-4H3,(H,24,27) |
| InChIKey | IWPITIDAMJFYMG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|