C22H40O4 — CID 142484199
(3aR,5S,8S,9R,11R,12aR)-5,12a-dihydroxy-2,5,8,9,11-pentamethyl-1,2,3a,4,6,7,8,9,10,11-decahydrocyclopenta[11]annulene-3,12-dione;propane (PubChem CID 142484199) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is (3aR,5S,8S,9R,11R,12aR)-5,12a-dihydroxy-2,5,8,9,11-pentamethyl-1,2,3a,4,6,7,8,9,10,11-decahydrocyclopenta[11]annulene-3,12-dione;propane.
| Compound Name | (3aR,5S,8S,9R,11R,12aR)-5,12a-dihydroxy-2,5,8,9,11-pentamethyl-1,2,3a,4,6,7,8,9,10,11-decahydrocyclopenta[11]annulene-3,12-dione;propane |
|---|---|
| PubChem CID | 142484199 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | (3aR,5S,8S,9R,11R,12aR)-5,12a-dihydroxy-2,5,8,9,11-pentamethyl-1,2,3a,4,6,7,8,9,10,11-decahydrocyclopenta[11]annulene-3,12-dione;propane |
| SMILES | CC1C[C@]2(O)C(=O)[C@H](C)C[C@@H](C)[C@@H](C)CC[C@](C)(O)C[C@H]2C1=O.CCC |
| InChI | InChI=1S/C19H32O4.C3H8/c1-11-6-7-18(5,22)10-15-16(20)14(4)9-19(15,23)17(21)13(3)8-12(11)2;1-3-2/h11-15,22-23H,6-10H2,1-5H3;3H2,1-2H3/t11-,12+,13+,14?,15-,18-,19+;/m0./s1 |
| InChIKey | AVYHKHUQVOBYMI-PGLPWUPISA-N |
| XLogP | 4.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |