C15H22 — CID 142484210
(2E,8E)-tricyclo[10.3.0.05,7]pentadeca-2,8-diene (PubChem CID 142484210) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is (2E,8E)-tricyclo[10.3.0.05,7]pentadeca-2,8-diene.
| Compound Name | (2E,8E)-tricyclo[10.3.0.05,7]pentadeca-2,8-diene |
|---|---|
| PubChem CID | 142484210 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (2E,8E)-tricyclo[10.3.0.05,7]pentadeca-2,8-diene |
| SMILES | C1=C/C2CC2C/C=C/C2CCCC2CC/1 |
| InChI | InChI=1S/C15H22/c1-2-6-14-11-15(14)10-4-9-13-8-3-7-12(13)5-1/h2,4,6,9,12-15H,1,3,5,7-8,10-11H2/b6-2+,9-4+ |
| InChIKey | PJHTWCWYBTUVIG-MXHAZWSOSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|