About CID 142485577
CID 142485577 (PubChem CID 142485577) has the molecular formula C27H39NO4Si-
and a molecular weight of 469.70 g/mol.
Molecular Properties
| Compound Name | CID 142485577 |
| PubChem CID | 142485577 |
| Molecular Formula | C27H39NO4Si- |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | — |
| SMILES | CC(=O)CC[C@@H](CO[Si-](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H39NO4Si/c1-21(29)18-19-22(28-25(30)32-26(2,3)4)20-31-33(27(5,6)7,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,22H,18-20H2,1-7H3,(H,28,30)/q-1/t22-/m0/s1 |
| InChIKey | HCXGOYJTNGDDGS-QFIPXVFZSA-N |
| XLogP | 4.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142485577 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142485577?
The IUPAC name of CID 142485577 (CID 142485577) is not available.
What is the SMILES notation for CID 142485577?
The canonical SMILES for CID 142485577 is CC(=O)CC[C@@H](CO[Si-](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C.
What is the InChIKey of CID 142485577?
The InChIKey is HCXGOYJTNGDDGS-QFIPXVFZSA-N. The full InChI is InChI=1S/C27H39NO4Si/c1-21(29)18-19-22(28-25(30)32-26(2,3)4)20-31-33(27(5,6)7,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,22H,18-20H2,1-7H3,(H,28,30)/q-1/t22-/m0/s1.
What are the key properties of CID 142485577?
CID 142485577 has a molecular weight of 469.70 g/mol, XLogP of 4.83, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142485577 is sourced from PubChem (CID 142485577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).