C21H20N4OS2 — CID 142485744
6-[(S)-butylsulfinyl]-4-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-5-amine (PubChem CID 142485744) has the molecular formula C21H20N4OS2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 6-[(S)-butylsulfinyl]-4-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-5-amine.
| Compound Name | 6-[(S)-butylsulfinyl]-4-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 142485744 |
| Molecular Formula | C21H20N4OS2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 6-[(S)-butylsulfinyl]-4-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-5-amine |
| SMILES | CCCC[S@](=O)c1sc2nc(-c3cccnc3)nc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C21H20N4OS2/c1-2-3-12-28(26)21-17(22)16-18(14-8-5-4-6-9-14)24-19(25-20(16)27-21)15-10-7-11-23-13-15/h4-11,13H,2-3,12,22H2,1H3/t28-/m0/s1 |
| InChIKey | JWGYQBOVQWBXET-NDEPHWFRSA-N |
| XLogP | 4.91 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |