About gold(1+);1-methylphospholane;pyrazol-1-ide
gold(1+);1-methylphospholane;pyrazol-1-ide (PubChem CID 142486413) has the molecular formula C8H14AuN2P
and a molecular weight of 366.16 g/mol. Its IUPAC name is gold(1+);1-methylphospholane;pyrazol-1-ide.
Molecular Properties
| Compound Name | gold(1+);1-methylphospholane;pyrazol-1-ide |
| PubChem CID | 142486413 |
| Molecular Formula | C8H14AuN2P |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | gold(1+);1-methylphospholane;pyrazol-1-ide |
| SMILES | CP1CCCC1.[Au+].c1cn[n-]c1 |
| InChI | InChI=1S/C5H11P.C3H3N2.Au/c1-6-4-2-3-5-6;1-2-4-5-3-1;/h2-5H2,1H3;1-3H;/q;-1;+1 |
| InChIKey | VUKIVCUPPZKGGL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 26.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);1-methylphospholane;pyrazol-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);1-methylphospholane;pyrazol-1-ide?
The IUPAC name of gold(1+);1-methylphospholane;pyrazol-1-ide (CID 142486413) is gold(1+);1-methylphospholane;pyrazol-1-ide.
What is the SMILES notation for gold(1+);1-methylphospholane;pyrazol-1-ide?
The canonical SMILES for gold(1+);1-methylphospholane;pyrazol-1-ide is CP1CCCC1.[Au+].c1cn[n-]c1.
What is the InChIKey of gold(1+);1-methylphospholane;pyrazol-1-ide?
The InChIKey is VUKIVCUPPZKGGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11P.C3H3N2.Au/c1-6-4-2-3-5-6;1-2-4-5-3-1;/h2-5H2,1H3;1-3H;/q;-1;+1.
What are the key properties of gold(1+);1-methylphospholane;pyrazol-1-ide?
gold(1+);1-methylphospholane;pyrazol-1-ide has a molecular weight of 366.16 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);1-methylphospholane;pyrazol-1-ide is sourced from PubChem (CID 142486413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).