About 5-ethylpyrrolo[3,2-c]pyridine
5-ethylpyrrolo[3,2-c]pyridine (PubChem CID 142486422) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 5-ethylpyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 5-ethylpyrrolo[3,2-c]pyridine |
| PubChem CID | 142486422 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 5-ethylpyrrolo[3,2-c]pyridine |
| SMILES | CCn1ccc2nccc-2c1 |
| InChI | InChI=1S/C9H10N2/c1-2-11-6-4-9-8(7-11)3-5-10-9/h3-7H,2H2,1H3 |
| InChIKey | NYHCDCLHFSVVPS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethylpyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylpyrrolo[3,2-c]pyridine?
The IUPAC name of 5-ethylpyrrolo[3,2-c]pyridine (CID 142486422) is 5-ethylpyrrolo[3,2-c]pyridine.
What is the SMILES notation for 5-ethylpyrrolo[3,2-c]pyridine?
The canonical SMILES for 5-ethylpyrrolo[3,2-c]pyridine is CCn1ccc2nccc-2c1.
What is the InChIKey of 5-ethylpyrrolo[3,2-c]pyridine?
The InChIKey is NYHCDCLHFSVVPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-2-11-6-4-9-8(7-11)3-5-10-9/h3-7H,2H2,1H3.
What are the key properties of 5-ethylpyrrolo[3,2-c]pyridine?
5-ethylpyrrolo[3,2-c]pyridine has a molecular weight of 146.19 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylpyrrolo[3,2-c]pyridine is sourced from PubChem (CID 142486422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).