C12H6ClFN2OS — CID 142487398
2-(7-chlorothieno[2,3-d]pyridazin-4-yl)-5-fluorophenol (PubChem CID 142487398) has the molecular formula C12H6ClFN2OS and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-(7-chlorothieno[2,3-d]pyridazin-4-yl)-5-fluorophenol.
| Compound Name | 2-(7-chlorothieno[2,3-d]pyridazin-4-yl)-5-fluorophenol |
|---|---|
| PubChem CID | 142487398 |
| Molecular Formula | C12H6ClFN2OS |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2-(7-chlorothieno[2,3-d]pyridazin-4-yl)-5-fluorophenol |
| SMILES | Oc1cc(F)ccc1-c1nnc(Cl)c2sccc12 |
| InChI | InChI=1S/C12H6ClFN2OS/c13-12-11-8(3-4-18-11)10(15-16-12)7-2-1-6(14)5-9(7)17/h1-5,17H |
| InChIKey | HCEZWWFNVHPKNU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |