About 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine
4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine (PubChem CID 142487547) has the molecular formula C17H15ClN2O3S
and a molecular weight of 362.84 g/mol. Its IUPAC name is 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine |
| PubChem CID | 142487547 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine |
| SMILES | Clc1nnc(-c2ccccc2OC[C@@H]2COCCO2)c2sccc12 |
| InChI | InChI=1S/C17H15ClN2O3S/c18-17-13-5-8-24-16(13)15(19-20-17)12-3-1-2-4-14(12)23-10-11-9-21-6-7-22-11/h1-5,8,11H,6-7,9-10H2/t11-/m0/s1 |
| InChIKey | UTNAQHYYQSHBAM-NSHDSACASA-N |
| XLogP | 3.81 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine?
The IUPAC name of 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine (CID 142487547) is 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine.
What is the SMILES notation for 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine?
The canonical SMILES for 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine is Clc1nnc(-c2ccccc2OC[C@@H]2COCCO2)c2sccc12.
What is the InChIKey of 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine?
The InChIKey is UTNAQHYYQSHBAM-NSHDSACASA-N. The full InChI is InChI=1S/C17H15ClN2O3S/c18-17-13-5-8-24-16(13)15(19-20-17)12-3-1-2-4-14(12)23-10-11-9-21-6-7-22-11/h1-5,8,11H,6-7,9-10H2/t11-/m0/s1.
What are the key properties of 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine?
4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine has a molecular weight of 362.84 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7-[2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenyl]thieno[2,3-d]pyridazine is sourced from PubChem (CID 142487547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).