C10H17NO — CID 14248785
1-(2,3,4,5-tetramethyl-2,5-dihydropyrrol-1-yl)ethanone (PubChem CID 14248785) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-(2,3,4,5-tetramethyl-2,5-dihydropyrrol-1-yl)ethanone.
| Compound Name | 1-(2,3,4,5-tetramethyl-2,5-dihydropyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 14248785 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-(2,3,4,5-tetramethyl-2,5-dihydropyrrol-1-yl)ethanone |
| SMILES | CC(=O)N1C(C)C(C)=C(C)C1C |
| InChI | InChI=1S/C10H17NO/c1-6-7(2)9(4)11(8(6)3)10(5)12/h8-9H,1-5H3 |
| InChIKey | GEFYWFCYXBGFGS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|