C23H27N — CID 142488116
4-[(3E,6Z)-2-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraen-3-yl]benzonitrile;prop-1-ene (PubChem CID 142488116) has the molecular formula C23H27N and a molecular weight of 317.48 g/mol. Its IUPAC name is 4-[(3E,6Z)-2-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraen-3-yl]benzonitrile;prop-1-ene.
| Compound Name | 4-[(3E,6Z)-2-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraen-3-yl]benzonitrile;prop-1-ene |
|---|---|
| PubChem CID | 142488116 |
| Molecular Formula | C23H27N |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 4-[(3E,6Z)-2-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraen-3-yl]benzonitrile;prop-1-ene |
| SMILES | C=C/C=C\C(/C=C(/C(=C)C)c1ccc(C#N)cc1)=C(C)C.C=CC |
| InChI | InChI=1S/C20H21N.C3H6/c1-6-7-8-19(15(2)3)13-20(16(4)5)18-11-9-17(14-21)10-12-18;1-3-2/h6-13H,1,4H2,2-3,5H3;3H,1H2,2H3/b8-7-,20-13+; |
| InChIKey | PLJJHXRFKLDMIM-QHCAGNKXSA-N |
| XLogP | 6.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|