C10H6F16N2 — CID 142488202
(E)-N,N'-bis(1,1,2,2,2-pentafluoroethyl)-N,N'-bis(trifluoromethyl)but-2-ene-1,4-diamine (PubChem CID 142488202) has the molecular formula C10H6F16N2 and a molecular weight of 458.14 g/mol. Its IUPAC name is (E)-N,N'-bis(1,1,2,2,2-pentafluoroethyl)-N,N'-bis(trifluoromethyl)but-2-ene-1,4-diamine.
| Compound Name | (E)-N,N'-bis(1,1,2,2,2-pentafluoroethyl)-N,N'-bis(trifluoromethyl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 142488202 |
| Molecular Formula | C10H6F16N2 |
| Molecular Weight | 458.14 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | (E)-N,N'-bis(1,1,2,2,2-pentafluoroethyl)-N,N'-bis(trifluoromethyl)but-2-ene-1,4-diamine |
| SMILES | FC(F)(F)N(C/C=C/CN(C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F16N2/c11-5(12,13)7(17,18)27(9(21,22)23)3-1-2-4-28(10(24,25)26)8(19,20)6(14,15)16/h1-2H,3-4H2/b2-1+ |
| InChIKey | CZHAGYGBWZBTBZ-OWOJBTEDSA-N |
| XLogP | 5.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.14 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|