C24H19FN6O2S2 — CID 142488275
4-[(4,5-dimethyl-1,3-thiazol-2-yl)diazenyl]-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-(4-methoxyphenyl)-1H-pyrazol-3-one (PubChem CID 142488275) has the molecular formula C24H19FN6O2S2 and a molecular weight of 506.59 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,3-thiazol-2-yl)diazenyl]-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-(4-methoxyphenyl)-1H-pyrazol-3-one.
| Compound Name | 4-[(4,5-dimethyl-1,3-thiazol-2-yl)diazenyl]-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-(4-methoxyphenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 142488275 |
| Molecular Formula | C24H19FN6O2S2 |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 4-[(4,5-dimethyl-1,3-thiazol-2-yl)diazenyl]-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-(4-methoxyphenyl)-1H-pyrazol-3-one |
| SMILES | COc1ccc(-c2[nH]n(-c3nc(-c4ccc(F)cc4)cs3)c(=O)c2/N=N/c2nc(C)c(C)s2)cc1 |
| InChI | InChI=1S/C24H19FN6O2S2/c1-13-14(2)35-23(26-13)29-28-21-20(16-6-10-18(33-3)11-7-16)30-31(22(21)32)24-27-19(12-34-24)15-4-8-17(25)9-5-15/h4-12,30H,1-3H3/b29-28+ |
| InChIKey | QWKKGPWAEUJYDC-ZQHSETAFSA-N |
| XLogP | 6.59 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|