C17H27FN2 — CID 142488462
(Z)-N-[(3Z)-3-ethyl-4-fluoropenta-1,3-dien-2-yl]-3-methyl-5-methylidene-N-(methylideneamino)hept-3-en-4-amine (PubChem CID 142488462) has the molecular formula C17H27FN2 and a molecular weight of 278.41 g/mol. Its IUPAC name is (Z)-N-[(3Z)-3-ethyl-4-fluoropenta-1,3-dien-2-yl]-3-methyl-5-methylidene-N-(methylideneamino)hept-3-en-4-amine.
| Compound Name | (Z)-N-[(3Z)-3-ethyl-4-fluoropenta-1,3-dien-2-yl]-3-methyl-5-methylidene-N-(methylideneamino)hept-3-en-4-amine |
|---|---|
| PubChem CID | 142488462 |
| Molecular Formula | C17H27FN2 |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (Z)-N-[(3Z)-3-ethyl-4-fluoropenta-1,3-dien-2-yl]-3-methyl-5-methylidene-N-(methylideneamino)hept-3-en-4-amine |
| SMILES | C=NN(C(=C)/C(CC)=C(/C)F)/C(C(=C)CC)=C(/C)CC |
| InChI | InChI=1S/C17H27FN2/c1-9-12(4)17(13(5)10-2)20(19-8)15(7)16(11-3)14(6)18/h4,7-11H2,1-3,5-6H3/b16-14-,17-13- |
| InChIKey | YWRSRDOFAWFKIQ-RGUYOHOBSA-N |
| XLogP | 5.72 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|