C30H25F4N5O2 — CID 142488627
18-ethyl-9-fluoro-8,15-dimethoxy-22-[5-(trifluoromethyl)pyrimidin-2-yl]-6,17,22-triazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),2,4,7,9,11(16),12,14,18-nonaene (PubChem CID 142488627) has the molecular formula C30H25F4N5O2 and a molecular weight of 563.56 g/mol. Its IUPAC name is 18-ethyl-9-fluoro-8,15-dimethoxy-22-[5-(trifluoromethyl)pyrimidin-2-yl]-6,17,22-triazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),2,4,7,9,11(16),12,14,18-nonaene.
| Compound Name | 18-ethyl-9-fluoro-8,15-dimethoxy-22-[5-(trifluoromethyl)pyrimidin-2-yl]-6,17,22-triazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),2,4,7,9,11(16),12,14,18-nonaene |
|---|---|
| PubChem CID | 142488627 |
| Molecular Formula | C30H25F4N5O2 |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 18-ethyl-9-fluoro-8,15-dimethoxy-22-[5-(trifluoromethyl)pyrimidin-2-yl]-6,17,22-triazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),2,4,7,9,11(16),12,14,18-nonaene |
| SMILES | CCc1c2c(c3c4c5cc[nH]c5c(OC)c(F)c4c4cccc(OC)c4n13)CN(c1ncc(C(F)(F)F)cn1)CC2 |
| InChI | InChI=1S/C30H25F4N5O2/c1-4-20-16-9-11-38(29-36-12-15(13-37-29)30(32,33)34)14-19(16)27-23-17-8-10-35-25(17)28(41-3)24(31)22(23)18-6-5-7-21(40-2)26(18)39(20)27/h5-8,10,12-13,35H,4,9,11,14H2,1-3H3 |
| InChIKey | DFKHXQNSPLXABP-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|