About S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate
S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate (PubChem CID 142489159) has the molecular formula C12H13N3O4S
and a molecular weight of 295.32 g/mol. Its IUPAC name is S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate.
Molecular Properties
| Compound Name | S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate |
| PubChem CID | 142489159 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate |
| SMILES | CC(=O)SCCC(=O)NCC#Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H13N3O4S/c1-8(16)20-6-4-10(17)13-5-2-3-9-7-14-12(19)15-11(9)18/h7H,4-6H2,1H3,(H,13,17)(H2,14,15,18,19) |
| InChIKey | NVXBAZMQKHLMCW-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate?
The IUPAC name of S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate (CID 142489159) is S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate.
What is the SMILES notation for S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate?
The canonical SMILES for S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate is CC(=O)SCCC(=O)NCC#Cc1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate?
The InChIKey is NVXBAZMQKHLMCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O4S/c1-8(16)20-6-4-10(17)13-5-2-3-9-7-14-12(19)15-11(9)18/h7H,4-6H2,1H3,(H,13,17)(H2,14,15,18,19).
What are the key properties of S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate?
S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate has a molecular weight of 295.32 g/mol, XLogP of -0.80, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3-[3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-ynylamino]-3-oxopropyl] ethanethioate is sourced from PubChem (CID 142489159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).