About 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine
2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine (PubChem CID 142489178) has the molecular formula C9H9N5
and a molecular weight of 187.21 g/mol. Its IUPAC name is 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine |
| PubChem CID | 142489178 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine |
| SMILES | Nc1ncnc2cc3c(cc12)NCN3 |
| InChI | InChI=1S/C9H9N5/c10-9-5-1-7-8(13-3-12-7)2-6(5)11-4-14-9/h1-2,4,12-13H,3H2,(H2,10,11,14) |
| InChIKey | HGZYQOPSENZRSD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine?
The IUPAC name of 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine (CID 142489178) is 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine.
What is the SMILES notation for 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine?
The canonical SMILES for 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine is Nc1ncnc2cc3c(cc12)NCN3.
What is the InChIKey of 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine?
The InChIKey is HGZYQOPSENZRSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5/c10-9-5-1-7-8(13-3-12-7)2-6(5)11-4-14-9/h1-2,4,12-13H,3H2,(H2,10,11,14).
What are the key properties of 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine?
2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine has a molecular weight of 187.21 g/mol, XLogP of 1.01, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine is sourced from PubChem (CID 142489178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).