C20H26N4O — CID 142489735
4-[[6-imino-1-(2-methylbutanimidoyl)-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 142489735) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 4-[[6-imino-1-(2-methylbutanimidoyl)-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 4-[[6-imino-1-(2-methylbutanimidoyl)-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 142489735 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 4-[[6-imino-1-(2-methylbutanimidoyl)-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | [H]/N=C(\C(C)CC)n1cc(OC2CCC(N)c3ccccc32)cc/c1=N\[H] |
| InChI | InChI=1S/C20H26N4O/c1-3-13(2)20(23)24-12-14(8-11-19(24)22)25-18-10-9-17(21)15-6-4-5-7-16(15)18/h4-8,11-13,17-18,22-23H,3,9-10,21H2,1-2H3/b22-19+,23-20+ |
| InChIKey | SRKMUKLTAOZXOJ-WDAKLKSISA-N |
| XLogP | 3.75 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|