C21H25FO3 — CID 142489816
3-[(9S,14S)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoic acid (PubChem CID 142489816) has the molecular formula C21H25FO3 and a molecular weight of 344.43 g/mol. Its IUPAC name is 3-[(9S,14S)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoic acid.
| Compound Name | 3-[(9S,14S)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoic acid |
|---|---|
| PubChem CID | 142489816 |
| Molecular Formula | C21H25FO3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-[(9S,14S)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoic acid |
| SMILES | CC12CC[C@@H]3c4cccc(F)c4CCC3[C@@H]1C(CCC(=O)O)CC2=O |
| InChI | InChI=1S/C21H25FO3/c1-21-10-9-14-13-3-2-4-17(22)15(13)6-7-16(14)20(21)12(11-18(21)23)5-8-19(24)25/h2-4,12,14,16,20H,5-11H2,1H3,(H,24,25)/t12?,14-,16?,20+,21?/m1/s1 |
| InChIKey | WPYYFKVLTPZXRV-XSDJQMRWSA-N |
| XLogP | 4.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |