About 3-amino propyl ethyl siloxane
3-amino propyl ethyl siloxane (PubChem CID 142489919) has the molecular formula C5H14NOSi
and a molecular weight of 132.26 g/mol.
Molecular Properties
| Compound Name | 3-amino propyl ethyl siloxane |
| PubChem CID | 142489919 |
| Molecular Formula | C5H14NOSi |
| Molecular Weight | 132.26 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | — |
| SMILES | CC[Si](O)CCCN |
| InChI | InChI=1S/C5H14NOSi/c1-2-8(7)5-3-4-6/h7H,2-6H2,1H3 |
| InChIKey | OUVOILBTUBPUGC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-amino propyl ethyl siloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino propyl ethyl siloxane?
The IUPAC name of 3-amino propyl ethyl siloxane (CID 142489919) is not available.
What is the SMILES notation for 3-amino propyl ethyl siloxane?
The canonical SMILES for 3-amino propyl ethyl siloxane is CC[Si](O)CCCN.
What is the InChIKey of 3-amino propyl ethyl siloxane?
The InChIKey is OUVOILBTUBPUGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14NOSi/c1-2-8(7)5-3-4-6/h7H,2-6H2,1H3.
What are the key properties of 3-amino propyl ethyl siloxane?
3-amino propyl ethyl siloxane has a molecular weight of 132.26 g/mol, XLogP of 0.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino propyl ethyl siloxane is sourced from PubChem (CID 142489919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).