C19H19N5O2S — CID 142490201
1-(N-cyano-S-pyridin-2-ylsulfonimidoyl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 142490201) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 1-(N-cyano-S-pyridin-2-ylsulfonimidoyl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-(N-cyano-S-pyridin-2-ylsulfonimidoyl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 142490201 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-(N-cyano-S-pyridin-2-ylsulfonimidoyl)-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | N#CN=S(=O)(NC(=O)Nc1c2c(cc3c1CCC3)CCC2)c1ccccn1 |
| InChI | InChI=1S/C19H19N5O2S/c20-12-22-27(26,17-9-1-2-10-21-17)24-19(25)23-18-15-7-3-5-13(15)11-14-6-4-8-16(14)18/h1-2,9-11H,3-8H2,(H2,22,23,24,25,26) |
| InChIKey | GDAHMFIDUIIGMC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|