About ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate
ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate (PubChem CID 142490362) has the molecular formula C10H12ClFO3
and a molecular weight of 234.65 g/mol. Its IUPAC name is ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate.
Molecular Properties
| Compound Name | ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate |
| PubChem CID | 142490362 |
| Molecular Formula | C10H12ClFO3 |
| Molecular Weight | 234.65 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate |
| SMILES | CCOC(=O)COC1=CCC(Cl)C(F)=C1 |
| InChI | InChI=1S/C10H12ClFO3/c1-2-14-10(13)6-15-7-3-4-8(11)9(12)5-7/h3,5,8H,2,4,6H2,1H3 |
| InChIKey | RSUYWWLPGUVPMX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.65 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate?
The IUPAC name of ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate (CID 142490362) is ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate.
What is the SMILES notation for ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate?
The canonical SMILES for ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate is CCOC(=O)COC1=CCC(Cl)C(F)=C1.
What is the InChIKey of ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate?
The InChIKey is RSUYWWLPGUVPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClFO3/c1-2-14-10(13)6-15-7-3-4-8(11)9(12)5-7/h3,5,8H,2,4,6H2,1H3.
What are the key properties of ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate?
ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate has a molecular weight of 234.65 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-chloro-5-fluorocyclohexa-1,5-dien-1-yl)oxyacetate is sourced from PubChem (CID 142490362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).