C11H15N5O4S — CID 142490525
6-[5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one;methanethiol (PubChem CID 142490525) has the molecular formula C11H15N5O4S and a molecular weight of 313.34 g/mol. Its IUPAC name is 6-[5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one;methanethiol.
| Compound Name | 6-[5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one;methanethiol |
|---|---|
| PubChem CID | 142490525 |
| Molecular Formula | C11H15N5O4S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 6-[5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one;methanethiol |
| SMILES | CS.NCC1CN(c2cnc3c(n2)NC(=O)CO3)C(=O)O1 |
| InChI | InChI=1S/C10H11N5O4.CH4S/c11-1-5-3-15(10(17)19-5)6-2-12-9-8(13-6)14-7(16)4-18-9;1-2/h2,5H,1,3-4,11H2,(H,13,14,16);2H,1H3 |
| InChIKey | YAJDKYZGALNEKQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|