C13H17F3O — CID 142491564
1-(2-ethoxypropan-2-yl)-2-(2,2,2-trifluoroethyl)benzene (PubChem CID 142491564) has the molecular formula C13H17F3O and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-(2-ethoxypropan-2-yl)-2-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 1-(2-ethoxypropan-2-yl)-2-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 142491564 |
| Molecular Formula | C13H17F3O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-(2-ethoxypropan-2-yl)-2-(2,2,2-trifluoroethyl)benzene |
| SMILES | CCOC(C)(C)c1ccccc1CC(F)(F)F |
| InChI | InChI=1S/C13H17F3O/c1-4-17-12(2,3)11-8-6-5-7-10(11)9-13(14,15)16/h5-8H,4,9H2,1-3H3 |
| InChIKey | QFBNELGCFHHSMW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |