About 1-sulfanylhex-5-en-2-ol
1-sulfanylhex-5-en-2-ol (PubChem CID 14249195) has the molecular formula C6H12OS
and a molecular weight of 132.23 g/mol. Its IUPAC name is 1-sulfanylhex-5-en-2-ol.
Molecular Properties
| Compound Name | 1-sulfanylhex-5-en-2-ol |
| PubChem CID | 14249195 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 1-sulfanylhex-5-en-2-ol |
| SMILES | C=CCCC(O)CS |
| InChI | InChI=1S/C6H12OS/c1-2-3-4-6(7)5-8/h2,6-8H,1,3-5H2 |
| InChIKey | VDICQZSUYPKYMU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfanylhex-5-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfanylhex-5-en-2-ol?
The IUPAC name of 1-sulfanylhex-5-en-2-ol (CID 14249195) is 1-sulfanylhex-5-en-2-ol.
What is the SMILES notation for 1-sulfanylhex-5-en-2-ol?
The canonical SMILES for 1-sulfanylhex-5-en-2-ol is C=CCCC(O)CS.
What is the InChIKey of 1-sulfanylhex-5-en-2-ol?
The InChIKey is VDICQZSUYPKYMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12OS/c1-2-3-4-6(7)5-8/h2,6-8H,1,3-5H2.
What are the key properties of 1-sulfanylhex-5-en-2-ol?
1-sulfanylhex-5-en-2-ol has a molecular weight of 132.23 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfanylhex-5-en-2-ol is sourced from PubChem (CID 14249195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).