About 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione
3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione (PubChem CID 142492006) has the molecular formula C12H14N2O6
and a molecular weight of 282.25 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione |
| PubChem CID | 142492006 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione |
| SMILES | CON1C(=O)CCC1=O.O=CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H7NO3.C5H7NO3/c9-5-1-4-8-6(10)2-3-7(8)11;1-9-6-4(7)2-3-5(6)8/h2-3,5H,1,4H2;2-3H2,1H3 |
| InChIKey | VADIAQRJBJHXQC-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione (CID 142492006) is 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione is CON1C(=O)CCC1=O.O=CCCN1C(=O)C=CC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione?
The InChIKey is VADIAQRJBJHXQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.C5H7NO3/c9-5-1-4-8-6(10)2-3-7(8)11;1-9-6-4(7)2-3-5(6)8/h2-3,5H,1,4H2;2-3H2,1H3.
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione?
3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione has a molecular weight of 282.25 g/mol, XLogP of -0.80, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)propanal;1-methoxypyrrolidine-2,5-dione is sourced from PubChem (CID 142492006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).