About [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid
[(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid (PubChem CID 142492729) has the molecular formula C22H30O9
and a molecular weight of 438.47 g/mol. Its IUPAC name is [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid.
Molecular Properties
| Compound Name | [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid |
| PubChem CID | 142492729 |
| Molecular Formula | C22H30O9 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid |
| SMILES | CCC(=O)O.CCC(=O)O[C@@H]1COC(Oc2ccccc2C(C)=O)C[C@H]1OC(=O)CC |
| InChI | InChI=1S/C19H24O7.C3H6O2/c1-4-17(21)24-15-10-19(23-11-16(15)25-18(22)5-2)26-14-9-7-6-8-13(14)12(3)20;1-2-3(4)5/h6-9,15-16,19H,4-5,10-11H2,1-3H3;2H2,1H3,(H,4,5)/t15-,16-,19?;/m1./s1 |
| InChIKey | QMPBNCUWNCVVRK-WHJWAZJASA-N |
| XLogP | 3.14 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid?
The IUPAC name of [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid (CID 142492729) is [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid.
What is the SMILES notation for [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid?
The canonical SMILES for [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid is CCC(=O)O.CCC(=O)O[C@@H]1COC(Oc2ccccc2C(C)=O)C[C@H]1OC(=O)CC.
What is the InChIKey of [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid?
The InChIKey is QMPBNCUWNCVVRK-WHJWAZJASA-N. The full InChI is InChI=1S/C19H24O7.C3H6O2/c1-4-17(21)24-15-10-19(23-11-16(15)25-18(22)5-2)26-14-9-7-6-8-13(14)12(3)20;1-2-3(4)5/h6-9,15-16,19H,4-5,10-11H2,1-3H3;2H2,1H3,(H,4,5)/t15-,16-,19?;/m1./s1.
What are the key properties of [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid?
[(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid has a molecular weight of 438.47 g/mol, XLogP of 3.14, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5R)-2-(2-acetylphenoxy)-5-propanoyloxyoxan-4-yl] propanoate;propanoic acid is sourced from PubChem (CID 142492729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).