About [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate
[2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate (PubChem CID 142492738) has the molecular formula C34H31N3O7
and a molecular weight of 593.64 g/mol. Its IUPAC name is [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate |
| PubChem CID | 142492738 |
| Molecular Formula | C34H31N3O7 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)OCC(O)C(COC(=O)Cc1c[nH]c2ccccc12)OC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C34H31N3O7/c38-30(19-42-32(39)13-21-16-35-27-10-4-1-7-24(21)27)31(44-34(41)15-23-18-37-29-12-6-3-9-26(23)29)20-43-33(40)14-22-17-36-28-11-5-2-8-25(22)28/h1-12,16-18,30-31,35-38H,13-15,19-20H2 |
| InChIKey | KIZMFURGVQVZCD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate?
The IUPAC name of [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate (CID 142492738) is [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate?
The canonical SMILES for [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate is O=C(Cc1c[nH]c2ccccc12)OCC(O)C(COC(=O)Cc1c[nH]c2ccccc12)OC(=O)Cc1c[nH]c2ccccc12.
What is the InChIKey of [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate?
The InChIKey is KIZMFURGVQVZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H31N3O7/c38-30(19-42-32(39)13-21-16-35-27-10-4-1-7-24(21)27)31(44-34(41)15-23-18-37-29-12-6-3-9-26(23)29)20-43-33(40)14-22-17-36-28-11-5-2-8-25(22)28/h1-12,16-18,30-31,35-38H,13-15,19-20H2.
What are the key properties of [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate?
[2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate has a molecular weight of 593.64 g/mol, XLogP of 4.52, 12 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hydroxy-3,4-bis[[2-(1H-indol-3-yl)acetyl]oxy]butyl] 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 142492738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).