C46H65N3O4Si2 — CID 142492774
(3S)-3-[tert-butyl(diphenyl)silyl]oxy-N-[3-[3-[[(3R)-3-[tert-butyl(diphenyl)silyl]oxybutanoyl]amino]propylamino]propyl]butanamide (PubChem CID 142492774) has the molecular formula C46H65N3O4Si2 and a molecular weight of 780.21 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(diphenyl)silyl]oxy-N-[3-[3-[[(3R)-3-[tert-butyl(diphenyl)silyl]oxybutanoyl]amino]propylamino]propyl]butanamide.
| Compound Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-N-[3-[3-[[(3R)-3-[tert-butyl(diphenyl)silyl]oxybutanoyl]amino]propylamino]propyl]butanamide |
|---|---|
| PubChem CID | 142492774 |
| Molecular Formula | C46H65N3O4Si2 |
| Molecular Weight | 780.21 g/mol |
| Exact Mass | 779.45 |
| IUPAC Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-N-[3-[3-[[(3R)-3-[tert-butyl(diphenyl)silyl]oxybutanoyl]amino]propylamino]propyl]butanamide |
| SMILES | C[C@H](CC(=O)NCCCNCCCNC(=O)C[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C46H65N3O4Si2/c1-37(52-54(45(3,4)5,39-23-13-9-14-24-39)40-25-15-10-16-26-40)35-43(50)48-33-21-31-47-32-22-34-49-44(51)36-38(2)53-55(46(6,7)8,41-27-17-11-18-28-41)42-29-19-12-20-30-42/h9-20,23-30,37-38,47H,21-22,31-36H2,1-8H3,(H,48,50)(H,49,51)/t37-,38+ |
| InChIKey | XMTDEWDXVCDAPM-MAZIBIHTSA-N |
| XLogP | 6.30 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.21 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|