About (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea
(2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea (PubChem CID 142493010) has the molecular formula C16H16N4O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea.
Molecular Properties
| Compound Name | (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea |
| PubChem CID | 142493010 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea |
| SMILES | NC(=O)NC1CN(c2ccccc2)c2ccccc2NC1=O |
| InChI | InChI=1S/C16H16N4O2/c17-16(22)19-13-10-20(11-6-2-1-3-7-11)14-9-5-4-8-12(14)18-15(13)21/h1-9,13H,10H2,(H,18,21)(H3,17,19,22) |
| InChIKey | OVHMPLMCPRLGGW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea?
The IUPAC name of (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea (CID 142493010) is (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea.
What is the SMILES notation for (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea?
The canonical SMILES for (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea is NC(=O)NC1CN(c2ccccc2)c2ccccc2NC1=O.
What is the InChIKey of (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea?
The InChIKey is OVHMPLMCPRLGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2/c17-16(22)19-13-10-20(11-6-2-1-3-7-11)14-9-5-4-8-12(14)18-15(13)21/h1-9,13H,10H2,(H,18,21)(H3,17,19,22).
What are the key properties of (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea?
(2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea has a molecular weight of 296.33 g/mol, XLogP of 1.81, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-5-phenyl-3,4-dihydro-1H-1,5-benzodiazepin-3-yl)urea is sourced from PubChem (CID 142493010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).