About N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine
N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine (PubChem CID 142493201) has the molecular formula C13H19F3N4
and a molecular weight of 288.32 g/mol. Its IUPAC name is N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine |
| PubChem CID | 142493201 |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)CCCc1cncnc1NC1CCNCC1 |
| InChI | InChI=1S/C13H19F3N4/c14-13(15,16)5-1-2-10-8-18-9-19-12(10)20-11-3-6-17-7-4-11/h8-9,11,17H,1-7H2,(H,18,19,20) |
| InChIKey | JKKXAFVWKRBZML-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine?
The IUPAC name of N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine (CID 142493201) is N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine.
What is the SMILES notation for N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine?
The canonical SMILES for N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine is FC(F)(F)CCCc1cncnc1NC1CCNCC1.
What is the InChIKey of N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine?
The InChIKey is JKKXAFVWKRBZML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N4/c14-13(15,16)5-1-2-10-8-18-9-19-12(10)20-11-3-6-17-7-4-11/h8-9,11,17H,1-7H2,(H,18,19,20).
What are the key properties of N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine?
N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine has a molecular weight of 288.32 g/mol, XLogP of 2.53, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-4-yl-5-(4,4,4-trifluorobutyl)pyrimidin-4-amine is sourced from PubChem (CID 142493201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).