About 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide
3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide (PubChem CID 142493347) has the molecular formula C8H12N4O3
and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide.
Molecular Properties
| Compound Name | 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide |
| PubChem CID | 142493347 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide |
| SMILES | CNNC(=O)C(CN)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H12N4O3/c1-10-11-8(15)5(4-9)12-6(13)2-3-7(12)14/h2-3,5,10H,4,9H2,1H3,(H,11,15) |
| InChIKey | RKSKYVBVLYTORV-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide?
The IUPAC name of 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide (CID 142493347) is 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide.
What is the SMILES notation for 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide?
The canonical SMILES for 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide is CNNC(=O)C(CN)N1C(=O)C=CC1=O.
What is the InChIKey of 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide?
The InChIKey is RKSKYVBVLYTORV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O3/c1-10-11-8(15)5(4-9)12-6(13)2-3-7(12)14/h2-3,5,10H,4,9H2,1H3,(H,11,15).
What are the key properties of 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide?
3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide has a molecular weight of 212.21 g/mol, XLogP of -2.51, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide is sourced from PubChem (CID 142493347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).