C26H27F5N6O3Si — CID 142494669
1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(5-methylpyridazin-3-yl)urea (PubChem CID 142494669) has the molecular formula C26H27F5N6O3Si and a molecular weight of 594.62 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(5-methylpyridazin-3-yl)urea.
| Compound Name | 1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(5-methylpyridazin-3-yl)urea |
|---|---|
| PubChem CID | 142494669 |
| Molecular Formula | C26H27F5N6O3Si |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | 1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(5-methylpyridazin-3-yl)urea |
| SMILES | Cc1cnnc(NC(=O)Nc2cc(F)c(Oc3ccnc4c3c(C(F)(F)F)cn4COCC[Si](C)(C)C)c(F)c2)c1 |
| InChI | InChI=1S/C26H27F5N6O3Si/c1-15-9-21(36-33-12-15)35-25(38)34-16-10-18(27)23(19(28)11-16)40-20-5-6-32-24-22(20)17(26(29,30)31)13-37(24)14-39-7-8-41(2,3)4/h5-6,9-13H,7-8,14H2,1-4H3,(H2,34,35,36,38) |
| InChIKey | QEOQLBOFJKRAMA-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|