C20H22F5N3O2Si — CID 142494681
3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyaniline (PubChem CID 142494681) has the molecular formula C20H22F5N3O2Si and a molecular weight of 459.49 g/mol. Its IUPAC name is 3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyaniline.
| Compound Name | 3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyaniline |
|---|---|
| PubChem CID | 142494681 |
| Molecular Formula | C20H22F5N3O2Si |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyaniline |
| SMILES | C[Si](C)(C)CCOCn1cc(C(F)(F)F)c2c(Oc3c(F)cc(N)cc3F)ccnc21 |
| InChI | InChI=1S/C20H22F5N3O2Si/c1-31(2,3)7-6-29-11-28-10-13(20(23,24)25)17-16(4-5-27-19(17)28)30-18-14(21)8-12(26)9-15(18)22/h4-5,8-10H,6-7,11,26H2,1-3H3 |
| InChIKey | VTJAMOWBLMXBOO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|