C21H23F5N2O2Si — CID 142494690
2-[[4-(2,6-difluoro-4-methylphenoxy)-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 142494690) has the molecular formula C21H23F5N2O2Si and a molecular weight of 458.50 g/mol. Its IUPAC name is 2-[[4-(2,6-difluoro-4-methylphenoxy)-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(2,6-difluoro-4-methylphenoxy)-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 142494690 |
| Molecular Formula | C21H23F5N2O2Si |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-[[4-(2,6-difluoro-4-methylphenoxy)-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(F)c(Oc2ccnc3c2c(C(F)(F)F)cn3COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C21H23F5N2O2Si/c1-13-9-15(22)19(16(23)10-13)30-17-5-6-27-20-18(17)14(21(24,25)26)11-28(20)12-29-7-8-31(2,3)4/h5-6,9-11H,7-8,12H2,1-4H3 |
| InChIKey | KNDMVRJTAIZWBU-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|