About 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde
3-aminocyclohepta-1,4,6-triene-1-carbaldehyde (PubChem CID 142495004) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde |
| PubChem CID | 142495004 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde |
| SMILES | NC1C=CC=CC(C=O)=C1 |
| InChI | InChI=1S/C8H9NO/c9-8-4-2-1-3-7(5-8)6-10/h1-6,8H,9H2 |
| InChIKey | LIDMERMDHVDKKK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde?
The IUPAC name of 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde (CID 142495004) is 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde.
What is the SMILES notation for 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde?
The canonical SMILES for 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde is NC1C=CC=CC(C=O)=C1.
What is the InChIKey of 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde?
The InChIKey is LIDMERMDHVDKKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c9-8-4-2-1-3-7(5-8)6-10/h1-6,8H,9H2.
What are the key properties of 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde?
3-aminocyclohepta-1,4,6-triene-1-carbaldehyde has a molecular weight of 135.17 g/mol, XLogP of 0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminocyclohepta-1,4,6-triene-1-carbaldehyde is sourced from PubChem (CID 142495004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).