About CID 142495511
CID 142495511 (PubChem CID 142495511) has the molecular formula C23H20F6N3O3S+
and a molecular weight of 532.49 g/mol.
Molecular Properties
| Compound Name | CID 142495511 |
| PubChem CID | 142495511 |
| Molecular Formula | C23H20F6N3O3S+ |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | — |
| SMILES | CC[SH+](=O)c1ccc2c(c1)CN(C(C)=O)C2C(=O)Nc1ccc(C(C#N)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H19F6N3O3S/c1-3-36(35)17-8-9-18-14(10-17)11-32(13(2)33)19(18)20(34)31-16-6-4-15(5-7-16)21(12-30,22(24,25)26)23(27,28)29/h4-10,19H,3,11H2,1-2H3,(H,31,34)/p+1 |
| InChIKey | YEOINLMGHUHLBQ-UHFFFAOYSA-O |
| XLogP | 4.69 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 142495511 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142495511?
The IUPAC name of CID 142495511 (CID 142495511) is not available.
What is the SMILES notation for CID 142495511?
The canonical SMILES for CID 142495511 is CC[SH+](=O)c1ccc2c(c1)CN(C(C)=O)C2C(=O)Nc1ccc(C(C#N)(C(F)(F)F)C(F)(F)F)cc1.
What is the InChIKey of CID 142495511?
The InChIKey is YEOINLMGHUHLBQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C23H19F6N3O3S/c1-3-36(35)17-8-9-18-14(10-17)11-32(13(2)33)19(18)20(34)31-16-6-4-15(5-7-16)21(12-30,22(24,25)26)23(27,28)29/h4-10,19H,3,11H2,1-2H3,(H,31,34)/p+1.
What are the key properties of CID 142495511?
CID 142495511 has a molecular weight of 532.49 g/mol, XLogP of 4.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142495511 is sourced from PubChem (CID 142495511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).