C15H18N2O6 — CID 142496575
(10R,12S,15R)-4-hydroxy-12,15-dimethyl-2,5-dioxo-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid (PubChem CID 142496575) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is (10R,12S,15R)-4-hydroxy-12,15-dimethyl-2,5-dioxo-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid.
| Compound Name | (10R,12S,15R)-4-hydroxy-12,15-dimethyl-2,5-dioxo-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid |
|---|---|
| PubChem CID | 142496575 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (10R,12S,15R)-4-hydroxy-12,15-dimethyl-2,5-dioxo-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid |
| SMILES | C[C@@H]1CC[C@H](C)O[C@@H]2Cn3cc(C(=O)O)c(=O)c(O)c3C(=O)N12 |
| InChI | InChI=1S/C15H18N2O6/c1-7-3-4-8(2)23-10-6-16-5-9(15(21)22)12(18)13(19)11(16)14(20)17(7)10/h5,7-8,10,19H,3-4,6H2,1-2H3,(H,21,22)/t7-,8+,10-/m1/s1 |
| InChIKey | UBKQZTBKAOXHFP-KHQFGBGNSA-N |
| XLogP | 0.62 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |