C16H20N2O6 — CID 142496585
(10R,12S,15R)-4-methoxy-12,15-dimethyl-2,5-dioxo-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid (PubChem CID 142496585) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is (10R,12S,15R)-4-methoxy-12,15-dimethyl-2,5-dioxo-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid.
| Compound Name | (10R,12S,15R)-4-methoxy-12,15-dimethyl-2,5-dioxo-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid |
|---|---|
| PubChem CID | 142496585 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (10R,12S,15R)-4-methoxy-12,15-dimethyl-2,5-dioxo-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid |
| SMILES | COc1c2n(cc(C(=O)O)c1=O)C[C@H]1O[C@@H](C)CC[C@@H](C)N1C2=O |
| InChI | InChI=1S/C16H20N2O6/c1-8-4-5-9(2)24-11-7-17-6-10(16(21)22)13(19)14(23-3)12(17)15(20)18(8)11/h6,8-9,11H,4-5,7H2,1-3H3,(H,21,22)/t8-,9+,11-/m1/s1 |
| InChIKey | HDBSIYMOKCRHQR-WCABBAIRSA-N |
| XLogP | 0.92 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |