C12H20OS2 — CID 142497796
2-[[(4Z,6Z,8Z)-deca-4,6,8-trien-5-yl]disulfanyl]ethanol (PubChem CID 142497796) has the molecular formula C12H20OS2 and a molecular weight of 244.42 g/mol. Its IUPAC name is 2-[[(4Z,6Z,8Z)-deca-4,6,8-trien-5-yl]disulfanyl]ethanol.
| Compound Name | 2-[[(4Z,6Z,8Z)-deca-4,6,8-trien-5-yl]disulfanyl]ethanol |
|---|---|
| PubChem CID | 142497796 |
| Molecular Formula | C12H20OS2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-[[(4Z,6Z,8Z)-deca-4,6,8-trien-5-yl]disulfanyl]ethanol |
| SMILES | C/C=C\C=C/C(=C/CCC)SSCCO |
| InChI | InChI=1S/C12H20OS2/c1-3-5-7-9-12(8-6-4-2)15-14-11-10-13/h3,5,7-9,13H,4,6,10-11H2,1-2H3/b5-3-,9-7-,12-8- |
| InChIKey | VVYANXUPOHAIAS-DAVAXLHXSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|