C32H36F3N7O4 — CID 142498115
[(2S)-1-[7-[[4-(trifluoromethyl)phenyl]methyl]-2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 142498115) has the molecular formula C32H36F3N7O4 and a molecular weight of 639.68 g/mol. Its IUPAC name is [(2S)-1-[7-[[4-(trifluoromethyl)phenyl]methyl]-2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[7-[[4-(trifluoromethyl)phenyl]methyl]-2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 142498115 |
| Molecular Formula | C32H36F3N7O4 |
| Molecular Weight | 639.68 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | [(2S)-1-[7-[[4-(trifluoromethyl)phenyl]methyl]-2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | COc1cc(-n2cnc(Nc3nc4c(c(N5CCC[C@H]5CO)n3)CCN(Cc3ccc(C(F)(F)F)cc3)C4)c2)cc(OC)c1OC |
| InChI | InChI=1S/C32H36F3N7O4/c1-44-26-13-23(14-27(45-2)29(26)46-3)41-17-28(36-19-41)38-31-37-25-16-40(15-20-6-8-21(9-7-20)32(33,34)35)12-10-24(25)30(39-31)42-11-4-5-22(42)18-43/h6-9,13-14,17,19,22,43H,4-5,10-12,15-16,18H2,1-3H3,(H,37,38,39)/t22-/m0/s1 |
| InChIKey | ASOLEONQPBMIKA-QFIPXVFZSA-N |
| XLogP | 4.97 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |