C25H35N7O3 — CID 142498134
ethane;2-pyrrolidin-1-yl-N-[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine (PubChem CID 142498134) has the molecular formula C25H35N7O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is ethane;2-pyrrolidin-1-yl-N-[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | ethane;2-pyrrolidin-1-yl-N-[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142498134 |
| Molecular Formula | C25H35N7O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | ethane;2-pyrrolidin-1-yl-N-[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CC.COc1cc(-n2cnc(Nc3nc(N4CCCC4)nc4c3CCNC4)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H29N7O3.C2H6/c1-31-18-10-15(11-19(32-2)21(18)33-3)30-13-20(25-14-30)27-22-16-6-7-24-12-17(16)26-23(28-22)29-8-4-5-9-29;1-2/h10-11,13-14,24H,4-9,12H2,1-3H3,(H,26,27,28);1-2H3 |
| InChIKey | BYZPGLPFGANUIQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |