About 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane
2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane (PubChem CID 142498170) has the molecular formula C17H16ClN5O
and a molecular weight of 341.80 g/mol. Its IUPAC name is 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane.
Molecular Properties
| Compound Name | 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane |
| PubChem CID | 142498170 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane |
| SMILES | CC.Clc1nc(Nc2cn(-c3ccccc3)cn2)c2occc2n1 |
| InChI | InChI=1S/C15H10ClN5O.C2H6/c16-15-18-11-6-7-22-13(11)14(20-15)19-12-8-21(9-17-12)10-4-2-1-3-5-10;1-2/h1-9H,(H,18,19,20);1-2H3 |
| InChIKey | XKAMBFPRDWLLBA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane?
The IUPAC name of 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane (CID 142498170) is 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane.
What is the SMILES notation for 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane?
The canonical SMILES for 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane is CC.Clc1nc(Nc2cn(-c3ccccc3)cn2)c2occc2n1.
What is the InChIKey of 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane?
The InChIKey is XKAMBFPRDWLLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClN5O.C2H6/c16-15-18-11-6-7-22-13(11)14(20-15)19-12-8-21(9-17-12)10-4-2-1-3-5-10;1-2/h1-9H,(H,18,19,20);1-2H3.
What are the key properties of 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane?
2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane has a molecular weight of 341.80 g/mol, XLogP of 4.83, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(1-phenylimidazol-4-yl)furo[3,2-d]pyrimidin-4-amine;ethane is sourced from PubChem (CID 142498170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).