C31H33N7O4 — CID 142498249
[(2S)-1-[7-(3-aminophenyl)-2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]quinazolin-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 142498249) has the molecular formula C31H33N7O4 and a molecular weight of 567.65 g/mol. Its IUPAC name is [(2S)-1-[7-(3-aminophenyl)-2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]quinazolin-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[7-(3-aminophenyl)-2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]quinazolin-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 142498249 |
| Molecular Formula | C31H33N7O4 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | [(2S)-1-[7-(3-aminophenyl)-2-[[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]amino]quinazolin-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | COc1cc(-n2cnc(Nc3nc(N4CCC[C@H]4CO)c4ccc(-c5cccc(N)c5)cc4n3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C31H33N7O4/c1-40-26-14-23(15-27(41-2)29(26)42-3)37-16-28(33-18-37)35-31-34-25-13-20(19-6-4-7-21(32)12-19)9-10-24(25)30(36-31)38-11-5-8-22(38)17-39/h4,6-7,9-10,12-16,18,22,39H,5,8,11,17,32H2,1-3H3,(H,34,35,36)/t22-/m0/s1 |
| InChIKey | IVUXOSJUVDFATQ-QFIPXVFZSA-N |
| XLogP | 4.80 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|